CAS 101990-46-9

N1-[(6-Bromo-3-pyridinyl)methyl]-1,2-ethanediamine

Description:

N1-[(6-Bromo-3-pyridinyl)methyl]-1,2-ethanediamine, identified by its CAS number 101990-46-9, is a chemical compound characterized by its structure, which includes a pyridine ring substituted with a bromine atom and a side chain featuring an ethanediamine moiety. This compound typically exhibits properties associated with both amines and heterocyclic compounds, such as basicity due to the presence of nitrogen atoms. The bromine substitution on the pyridine ring can influence its reactivity and solubility in various solvents. It may also participate in hydrogen bonding due to the amine groups, affecting its interactions in biological systems. This compound is of interest in medicinal chemistry, potentially serving as a scaffold for drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for its pharmacological properties in relevant biological assays. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.

Formula: C₈H₁₂BrN₃

InChI: InChI=1S/C8H12BrN3/c9-8-2-1-7(6-12-8)5-11-4-3-10/h1-2,6,11H,3-5,10H2

InChI key: InChIKey=BYNSHXYIGAKGPE-UHFFFAOYSA-N

SMILES: C(NCCN)C=1C=CC(Br)=NC1

Synonyms:

• 1,2-Ethanediamine, N1-[(6-bromo-3-pyridinyl)methyl]-
• 1,2-Ethanediamine, N-[(6-bromo-3-pyridinyl)methyl]-
• N1-[(6-Bromo-3-pyridinyl)methyl]-1,2-ethanediamine
• (2-Aminoethyl)[(6-bromopyridin-3-yl)methyl]amine
• 1,2-Ethanediamine N1-[(6-bromo-3-pyridinyl)methyl]-