
CAS 1019918-43-4
:7-Bromo-3-(2-fluorophenyl)-1,2,4-triazolo[4,3-a]pyridine
Description:
7-Bromo-3-(2-fluorophenyl)-1,2,4-triazolo[4,3-a]pyridine is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a pyridine moiety. The presence of a bromine atom at the 7-position and a fluorophenyl group at the 3-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen substituents that can enhance biological interactions. The compound may also display interesting electronic properties owing to the electron-withdrawing nature of the fluorine atom and the aromatic character of the triazole and pyridine rings. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile building block in organic synthesis.
Formula:C12H7BrFN3
InChI:InChI=1S/C12H7BrFN3/c13-8-5-6-17-11(7-8)15-16-12(17)9-3-1-2-4-10(9)14/h1-7H
InChI key:InChIKey=AETLBVTWXFMIAA-UHFFFAOYSA-N
SMILES:FC1=C(C=2N3C(=NN2)C=C(Br)C=C3)C=CC=C1
Synonyms:- 7-Bromo-3-(2-fluorophenyl)-1,2,4-triazolo[4,3-a]pyridine
- 1,2,4-Triazolo[4,3-a]pyridine, 7-bromo-3-(2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-Bromo-3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine
CAS:Formula:C12H7BrFN3Molecular weight:292.1065
