CymitQuimica logo

CAS 101993-02-6

:

4,5-Dihydro-5-(methoxymethyl)-2-oxazolamine

Description:
4,5-Dihydro-5-(methoxymethyl)-2-oxazolamine, with the CAS number 101993-02-6, is a chemical compound characterized by its oxazoline structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically exhibits properties associated with heterocycles, including potential reactivity due to the presence of the nitrogen atom, which can participate in various chemical reactions such as nucleophilic substitutions. The methoxymethyl group enhances its solubility in organic solvents and may influence its biological activity. The dihydro form indicates that it has two hydrogen atoms added to the oxazole ring, which can affect its stability and reactivity. This compound may be of interest in medicinal chemistry due to its structural features, which could contribute to biological activity or serve as a precursor in the synthesis of more complex molecules. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the sample.
Formula:C5H10N2O2
InChI:InChI=1S/C5H10N2O2/c1-8-3-4-2-7-5(6)9-4/h4H,2-3H2,1H3,(H2,6,7)
InChI key:InChIKey=QYLDKTPSEAWJNL-UHFFFAOYSA-N
SMILES:C(OC)C1OC(N)=NC1
Synonyms:
  • 4,5-Dihydro-5-(methoxymethyl)-2-oxazolamine
  • 2-Oxazolamine, 4,5-dihydro-5-(methoxymethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.