CAS 101999-46-6

2-(2-oxobenzo[h]chromen-4-yl)acetic acid

Description:

2-(2-Oxobenzo[h]chromen-4-yl)acetic acid, with the CAS number 101999-46-6, is a chemical compound that features a complex structure characterized by a benzo[h]chromene moiety. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, which may contribute to its potential biological activity. The presence of the oxo group suggests that it may participate in various chemical reactions, including nucleophilic attacks or coordination with metal ions. Its acetic acid component indicates that it can act as a weak acid, capable of donating protons in solution. The compound may also display interesting solubility characteristics, depending on the solvent used, and could potentially engage in hydrogen bonding due to the carboxylic acid group. Additionally, compounds of this type are often studied for their pharmacological properties, including anti-inflammatory or antioxidant activities, making them of interest in medicinal chemistry. Overall, 2-(2-oxobenzo[h]chromen-4-yl)acetic acid represents a unique structure with potential applications in various fields of research.

Formula: C₁₅H₁₀O₄

InChI: InChI=1/C15H10O4/c16-13(17)7-10-8-14(18)19-15-11-4-2-1-3-9(11)5-6-12(10)15/h1-6,8H,7H2,(H,16,17)

SMILES: c1ccc2c(c1)ccc1c(CC(=O)O)cc(=O)oc21

(2-oxo-2H-benzo[h]chromen-4-yl)acetic acid

CAS: 101999-46-6

Formula: C₁₅H₁₀O₄

Molecular weight: 254.2375

Ref: IN-DA00067E

(2-oxo-2H-benzo[h]chromen-4-yl)acetic acid

CAS: 101999-46-6

Purity: 95.0%

Molecular weight: 254.24099731445312

Ref: 10-F313907