CAS 102-03-4
:N-[(Phenylamino)carbonyl]acetamide
Description:
N-[(Phenylamino)carbonyl]acetamide, also known as phenylurea or N-phenylurea, is an organic compound characterized by its amide functional group and a phenyl group attached to a carbonyl. This compound typically appears as a white to off-white crystalline solid. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. The presence of the phenylamino group contributes to its potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. N-[(Phenylamino)carbonyl]acetamide can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the reactivity of its amide bond. Its melting point and boiling point can vary depending on purity and environmental conditions. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, this compound serves as a valuable intermediate in organic synthesis and has applications in medicinal chemistry.
Formula:C9H10N2O2
InChI:InChI=1S/C9H10N2O2/c1-7(12)10-9(13)11-8-5-3-2-4-6-8/h2-6H,1H3,(H2,10,11,12,13)
InChI key:InChIKey=RUPVBKFFZNPEPS-UHFFFAOYSA-N
SMILES:N(C(NC(C)=O)=O)C1=CC=CC=C1
Synonyms:- 3-Acetyl-1-phenylurea
- Acetamide, N-[(phenylamino)carbonyl]-
- N-(phenylcarbamoyl)acetamide
- N-Acetyl-N′-phenylurea
- N-Phenyl-N-acetylurea
- N-[(Phenylamino)carbonyl]acetamide
- NSC 60262
- Phenylureidoacetic acid
- Urea, 1-acetyl-3-phenyl-
- 1-Acetyl-3-phenylurea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

