CymitQuimica logo

CAS 102-10-3

:

Phosphorous acid, diphenyl ester

Description:
Phosphorous acid, diphenyl ester, also known as diphenyl phosphite, is an organophosphorus compound characterized by its structure, which includes a phosphorus atom bonded to two phenyl groups and an oxygen atom. This compound is typically a colorless to pale yellow liquid with a mild, aromatic odor. It is soluble in organic solvents but has limited solubility in water. Diphenyl phosphite is primarily used as a plasticizer and stabilizer in various polymer formulations, particularly in the production of polyvinyl chloride (PVC) and other plastics. Additionally, it serves as an antioxidant and a flame retardant in certain applications. The compound exhibits moderate toxicity, and appropriate safety measures should be taken when handling it, as it can cause irritation to the skin and eyes. Its chemical properties include the ability to undergo hydrolysis, leading to the formation of phosphorous acid and phenol under certain conditions. Overall, diphenyl phosphite plays a significant role in enhancing the performance and longevity of materials in industrial applications.
Formula:C12H11O3P
InChI:InChI=1S/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,13H
InChI key:InChIKey=FYOYCZHNDCCGCE-UHFFFAOYSA-N
SMILES:O(P(OC1=CC=CC=C1)O)C2=CC=CC=C2
Synonyms:
  • Phosphorous acid, diphenyl ester
  • NSC 203171
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.