
CAS 102-26-1
:2,4,6-Triethylhexahydro-1,3,5-triazine
Description:
2,4,6-Triethylhexahydro-1,3,5-triazine, with the CAS number 102-26-1, is a cyclic organic compound belonging to the triazine family. It features a six-membered ring containing three nitrogen atoms and three carbon atoms, which contributes to its unique chemical properties. This compound is characterized by its relatively low molecular weight and moderate polarity, making it soluble in various organic solvents. It typically exhibits a colorless to pale yellow appearance and has a distinctive odor. The presence of ethyl groups enhances its hydrophobic characteristics, influencing its reactivity and interactions with other substances. 2,4,6-Triethylhexahydro-1,3,5-triazine is known for its applications in the synthesis of other chemical compounds and may serve as an intermediate in various industrial processes. Additionally, it may exhibit biological activity, although specific toxicological data should be consulted for safety assessments. Overall, its structural features and functional groups make it a compound of interest in both research and industrial chemistry.
Formula:C9H21N3
InChI:InChI=1S/C9H21N3/c1-4-7-10-8(5-2)12-9(6-3)11-7/h7-12H,4-6H2,1-3H3
InChI key:InChIKey=BAPJNTSMYWUXMK-UHFFFAOYSA-N
SMILES:C(C)C1NC(CC)NC(CC)N1
Synonyms:- 2,4,6-Triethyl-1,3,5-triazinane
- 2,4,6-Triethylhexahydro-1,3,5-triazine
- s-Triazine, 2,4,6-triethylhexahydro-
- 1,3,5-Triazine, 2,4,6-triethylhexahydro-
- 2,4,6-Triethylhexahydro-s-triazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
