CymitQuimica logo

CAS 102-58-9

:

5-Octen-4-ol, 2,7-dimethyl-, 4-acetate

Description:
5-Octen-4-ol, 2,7-dimethyl-, 4-acetate, commonly referred to as a type of acetate ester, is a chemical compound characterized by its unique structure that includes a long carbon chain and functional groups. This compound features a double bond in its carbon chain, which contributes to its reactivity and potential applications in organic synthesis. The presence of the acetate group indicates that it can participate in esterification reactions and may exhibit properties typical of esters, such as pleasant, fruity odors. It is often used in the fragrance and flavor industry due to its aromatic qualities. Additionally, the compound may have applications in the production of various chemical intermediates. Its physical properties, such as boiling point and solubility, can vary based on the specific conditions and purity of the substance. Safety data should be consulted to understand its handling and potential hazards, as with any chemical compound. Overall, 5-Octen-4-ol, 2,7-dimethyl-, 4-acetate is a versatile compound with significance in both industrial and research contexts.
Formula:C12H22O2
InChI:InChI=1S/C12H22O2/c1-9(2)6-7-12(8-10(3)4)14-11(5)13/h6-7,9-10,12H,8H2,1-5H3
InChI key:InChIKey=DFQXLTAVDYXAOP-UHFFFAOYSA-N
SMILES:C(C=CC(C)C)(CC(C)C)OC(C)=O
Synonyms:
  • 5-Octen-4-ol, 2,7-dimethyl-, acetate
  • 5-Octen-4-ol, 2,7-dimethyl-, 4-acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.