
CAS 102-61-4
:3,5-Dihydroxystilbene
Description:
3,5-Dihydroxystilbene, with the CAS number 102-61-4, is an organic compound belonging to the stilbene family, characterized by its two phenolic hydroxyl groups located at the 3 and 5 positions of the stilbene backbone. This compound typically appears as a crystalline solid and is known for its potential biological activities, including antioxidant properties. It exhibits a conjugated double bond system, which contributes to its ability to absorb ultraviolet light, making it useful in various applications, including photochemistry and materials science. The presence of hydroxyl groups enhances its solubility in polar solvents and allows for hydrogen bonding, influencing its reactivity and interaction with other molecules. 3,5-Dihydroxystilbene has garnered interest in research for its potential therapeutic effects, particularly in the context of cardiovascular health and cancer prevention. However, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application.
Formula:C14H12O2
InChI:InChI=1S/C14H12O2/c15-13-8-12(9-14(16)10-13)7-6-11-4-2-1-3-5-11/h1-10,15-16H
InChI key:InChIKey=YCVPRTHEGLPYPB-UHFFFAOYSA-N
SMILES:C(=CC1=CC=CC=C1)C2=CC(O)=CC(O)=C2
Synonyms:- 3,5-Dihydroxystilbene
- 5-(2-Phenylethenyl)-1,3-benzenediol
- 1,3-Benzenediol, 5-(2-phenylethenyl)-
- Resorcinol, 5-styryl-
- 3,5-Stilbenediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.