CymitQuimica logo

CAS 102-80-7

:

N1,N1,N2,N2-Tetrapentyl-1,2-ethanediamine

Description:
N1,N1,N2,N2-Tetrapentyl-1,2-ethanediamine, with the CAS number 102-80-7, is an organic compound characterized by its structure, which features a central ethane backbone with two amine functional groups and four pentyl chains attached to the nitrogen atoms. This compound is a type of diamine, which means it contains two amine groups (-NH2) that can participate in various chemical reactions, including those typical of amines, such as nucleophilic substitutions and the formation of salts. The presence of long pentyl chains contributes to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. This hydrophobicity can influence its behavior in biological systems and its potential applications in materials science, such as in the synthesis of surfactants or polymers. Additionally, the compound's amine groups may allow for interactions with other chemical species, making it useful in various chemical processes or as a ligand in coordination chemistry. Overall, its unique structure and properties make it a compound of interest in both industrial and research settings.
Formula:C22H48N2
InChI:InChI=1S/C22H48N2/c1-5-9-13-17-23(18-14-10-6-2)21-22-24(19-15-11-7-3)20-16-12-8-4/h5-22H2,1-4H3
InChI key:InChIKey=MPAOWNJUCRLLEQ-UHFFFAOYSA-N
SMILES:N(CCN(CCCCC)CCCCC)(CCCCC)CCCCC
Synonyms:
  • 1,2-Ethanediamine, N,N,N′,N′-tetrapentyl-
  • Ethylenediamine, N,N,N′,N′-tetrapentyl-
  • N,N,N′,N′-Tetrapentylethylenediamine
  • N1,N1,N2,N2-Tetrapentyl-1,2-ethanediamine
  • 1,2-Ethanediamine, N1,N1,N2,N2-tetrapentyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.