CAS 1020-67-3
:Ethyl 3-(benzylamino)but-2-enoate
Description:
Ethyl 3-(benzylamino)but-2-enoate, with the CAS number 1020-67-3, is an organic compound characterized by its structure, which includes an ethyl ester group and a benzylamino substituent attached to a but-2-enoate backbone. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic benzyl group. Ethyl 3-(benzylamino)but-2-enoate may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its reactivity is influenced by the presence of the double bond in the but-2-enoate moiety, which can participate in various chemical reactions, including addition and polymerization. The compound's properties, such as boiling point, melting point, and density, can vary based on purity and environmental conditions. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested. Overall, this compound serves as a valuable intermediate in organic synthesis and potential therapeutic applications.
Formula:C13H17NO2
InChI:InChI=1/C13H17NO2/c1-3-16-13(15)9-11(2)14-10-12-7-5-4-6-8-12/h4-9,14H,3,10H2,1-2H3/b11-9+
Synonyms:- 3-Benzylamino-but-2-enoic acid ethyl ester
- ethyl (2E)-3-(benzylamino)but-2-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 3-(benzylamino)but-2-enoate
CAS:Formula:C13H17NO2Color and Shape:SolidMolecular weight:219.2796
