CAS 1020-71-9

4,4¥-[Dithiobis(methylene)bispyridine

Description:

4,4'-[Dithiobis(methylene)bispyridine], with the CAS number 1020-71-9, is an organic compound characterized by its unique structure featuring two pyridine rings connected by a dithiobis(methylene) linker. This compound is typically a yellow to orange solid, exhibiting moderate solubility in polar organic solvents. It is known for its ability to form coordination complexes with various metal ions, making it useful in coordination chemistry and materials science. The presence of sulfur atoms in its structure contributes to its reactivity, particularly in redox reactions and as a ligand in metal complexation. Additionally, 4,4'-[Dithiobis(methylene)bispyridine] can participate in various chemical reactions, including nucleophilic substitutions and polymerization processes. Its applications extend to fields such as catalysis, sensor development, and the synthesis of novel materials. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled, and proper storage conditions are necessary to maintain its stability.

Formula: C₁₂H₁₂N₂S₂

InChI: InChI=1/C12H12N2S2/c1-5-13-6-2-11(1)9-15-16-10-12-3-7-14-8-4-12/h1-8H,9-10H2

Synonyms:

• Bis(4-pyridylmethyl) disulfide
• 4,4-(Dithiodimethylene)dipyridine
• 4,4'-(disulfanediyldimethanediyl)dipyridine

Pyridine, 4,4'-[dithiobis(methylene)]bis-

CAS: 1020-71-9

Formula: C₁₂H₁₂N₂S₂

Molecular weight: 248.3671

Ref: IN-DA0006A8