CAS 1020046-28-9

2-[4-(4H-1,2,4-Triazol-4-yl)phenoxy]acetic acid

Description:

2-[4-(4H-1,2,4-Triazol-4-yl)phenoxy]acetic acid, with the CAS number 1020046-28-9, is a chemical compound characterized by its unique structure that includes a phenoxy group and a triazole moiety. This compound typically exhibits properties associated with both the phenolic and carboxylic acid functional groups, which can influence its solubility and reactivity. It is often studied for its potential applications in agricultural chemistry, particularly as a plant growth regulator or herbicide, due to its ability to interact with biological systems. The presence of the triazole ring may also impart antifungal properties, making it of interest in various fields, including pharmaceuticals and crop protection. Additionally, the compound's stability, solubility in organic solvents, and reactivity with other chemical species can vary based on environmental conditions such as pH and temperature. Overall, 2-[4-(4H-1,2,4-Triazol-4-yl)phenoxy]acetic acid represents a versatile chemical with potential applications across multiple disciplines.

Formula: C₁₀H₉N₃O₃

InChI: InChI=1S/C10H9N3O3/c14-10(15)5-16-9-3-1-8(2-4-9)13-6-11-12-7-13/h1-4,6-7H,5H2,(H,14,15)

InChI key: InChIKey=BRQJYQFRCVYIKD-UHFFFAOYSA-N

SMILES: O(CC(O)=O)C1=CC=C(C=C1)N2C=NN=C2

Synonyms:

• 2-[4-(4H-1,2,4-Triazol-4-yl)phenoxy]acetic acid
• Acetic acid, 2-[4-(4H-1,2,4-triazol-4-yl)phenoxy]-