CymitQuimica logo

CAS 1020053-92-2

:

N-(5-Amino-2-fluorophenyl)-3-propoxybenzamide

Description:
N-(5-Amino-2-fluorophenyl)-3-propoxybenzamide is a chemical compound characterized by its specific functional groups and structural features. It contains an amine group (-NH2) and a fluorine atom attached to a phenyl ring, which contributes to its potential biological activity. The presence of a propoxy group (-O-CH2-CH2-CH3) linked to another benzene ring enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its molecular structure suggests potential interactions with various biological targets, making it a candidate for further research in drug development. Additionally, the presence of both polar and non-polar regions in its structure may affect its pharmacokinetics and pharmacodynamics. As with many compounds, safety and toxicity assessments are essential for understanding its suitability for therapeutic applications.
Formula:C16H17FN2O2
InChI:InChI=1S/C16H17FN2O2/c1-2-8-21-13-5-3-4-11(9-13)16(20)19-15-10-12(18)6-7-14(15)17/h3-7,9-10H,2,8,18H2,1H3,(H,19,20)
InChI key:InChIKey=FVIBZVJMENHDEM-UHFFFAOYSA-N
SMILES:C(NC1=C(F)C=CC(N)=C1)(=O)C2=CC(OCCC)=CC=C2
Synonyms:
  • N-(5-Amino-2-fluorophenyl)-3-propoxybenzamide
  • Benzamide, N-(5-amino-2-fluorophenyl)-3-propoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.