CAS 1020054-15-2

N-(5-Amino-2-methylphenyl)-3-(3-methylbutoxy)benzamide

Description:

N-(5-Amino-2-methylphenyl)-3-(3-methylbutoxy)benzamide, with the CAS number 1020054-15-2, is a chemical compound characterized by its amide functional group, which is indicative of its potential biological activity. The structure features an aromatic system, suggesting stability and possible interactions with biological targets. The presence of an amino group enhances its solubility in polar solvents and may contribute to its reactivity, while the alkoxy side chain (3-methylbutoxy) can influence its lipophilicity and membrane permeability. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological pathways. Its specific characteristics, such as melting point, boiling point, and solubility, would typically be determined through experimental methods. Additionally, the compound's safety profile and potential toxicity would need to be assessed in accordance with regulatory guidelines if intended for therapeutic use. Overall, this compound represents a class of molecules that could have significant implications in drug discovery and development.

Formula: C₁₉H₂₄N₂O₂

InChI: InChI=1S/C19H24N2O2/c1-13(2)9-10-23-17-6-4-5-15(11-17)19(22)21-18-12-16(20)8-7-14(18)3/h4-8,11-13H,9-10,20H2,1-3H3,(H,21,22)

InChI key: InChIKey=QLPMNGRPEAWBPG-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC(OCCC(C)C)=CC=C1)C2=C(C)C=CC(N)=C2

Synonyms:

• N-(5-Amino-2-methylphenyl)-3-(3-methylbutoxy)benzamide
• Benzamide, N-(5-amino-2-methylphenyl)-3-(3-methylbutoxy)-