
CAS 1020054-41-4
:N-(3-Aminophenyl)-2-(2-ethoxyethoxy)benzamide
Description:
N-(3-Aminophenyl)-2-(2-ethoxyethoxy)benzamide, identified by its CAS number 1020054-41-4, is an organic compound characterized by its amide functional group and aromatic structure. This compound features a benzamide core, which is substituted with an amino group on one aromatic ring and an ethoxyethoxy group on the other. The presence of the amino group contributes to its potential as a building block in pharmaceuticals, particularly in the development of compounds with biological activity. The ethoxyethoxy substituent enhances its solubility in organic solvents, which can be advantageous for various applications, including drug formulation. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its stability and reactivity can be influenced by the electronic effects of the substituents, which may affect its pharmacokinetic properties. Overall, N-(3-Aminophenyl)-2-(2-ethoxyethoxy)benzamide represents a versatile structure for further exploration in chemical and pharmaceutical research.
Formula:C17H20N2O3
InChI:InChI=1S/C17H20N2O3/c1-2-21-10-11-22-16-9-4-3-8-15(16)17(20)19-14-7-5-6-13(18)12-14/h3-9,12H,2,10-11,18H2,1H3,(H,19,20)
InChI key:InChIKey=AQMACSLHSZWGLM-UHFFFAOYSA-N
SMILES:C(NC1=CC(N)=CC=C1)(=O)C2=C(OCCOCC)C=CC=C2
Synonyms:- Benzamide, N-(3-aminophenyl)-2-(2-ethoxyethoxy)-
- N-(3-Aminophenyl)-2-(2-ethoxyethoxy)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.