
CAS 1020054-44-7
:N-(3-Aminophenyl)-3-(2-ethoxyethoxy)benzamide
Description:
N-(3-Aminophenyl)-3-(2-ethoxyethoxy)benzamide, identified by its CAS number 1020054-44-7, is an organic compound characterized by its amide functional group and aromatic structure. This compound features a benzamide core, which is substituted with an amino group on one aromatic ring and an ethoxyethoxy group on another. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it of interest in various chemical and biological applications. The ethoxyethoxy substituent contributes to the compound's solubility properties, potentially enhancing its compatibility with organic solvents. The molecular structure indicates that it may exhibit specific interactions with biological targets, which could be relevant in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, making it a candidate for further investigation in drug development or as a chemical probe in research settings. Overall, N-(3-Aminophenyl)-3-(2-ethoxyethoxy)benzamide presents a unique combination of functional groups that may impart interesting properties for various applications.
Formula:C17H20N2O3
InChI:InChI=1S/C17H20N2O3/c1-2-21-9-10-22-16-8-3-5-13(11-16)17(20)19-15-7-4-6-14(18)12-15/h3-8,11-12H,2,9-10,18H2,1H3,(H,19,20)
InChI key:InChIKey=CICNFQZCCGDBIU-UHFFFAOYSA-N
SMILES:C(NC1=CC(N)=CC=C1)(=O)C2=CC(OCCOCC)=CC=C2
Synonyms:- N-(3-Aminophenyl)-3-(2-ethoxyethoxy)benzamide
- Benzamide, N-(3-aminophenyl)-3-(2-ethoxyethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.