CymitQuimica logo

CAS 1020054-48-1

:

N-(5-Amino-2-methoxyphenyl)-2-(2,4-dichlorophenoxy)propanamide

Description:
N-(5-Amino-2-methoxyphenyl)-2-(2,4-dichlorophenoxy)propanamide, identified by its CAS number 1020054-48-1, is a chemical compound characterized by its complex structure, which includes an amine group, a methoxy group, and a dichlorophenoxy moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to the presence of the amino group. The dichlorophenoxy group may impart specific interactions with biological targets, making it of interest in pharmaceutical research. The presence of chlorine atoms can enhance lipophilicity and influence the compound's reactivity and stability. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially modulating its interaction with enzymes or receptors. Overall, this compound's unique functional groups suggest it may have applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully understand its biological activity and potential uses.
Formula:C16H16Cl2N2O3
InChI:InChI=1S/C16H16Cl2N2O3/c1-9(23-14-5-3-10(17)7-12(14)18)16(21)20-13-8-11(19)4-6-15(13)22-2/h3-9H,19H2,1-2H3,(H,20,21)
InChI key:InChIKey=HAQHRYSSNZJCQY-UHFFFAOYSA-N
SMILES:N(C(C(OC1=C(Cl)C=C(Cl)C=C1)C)=O)C2=C(OC)C=CC(N)=C2
Synonyms:
  • N-(5-Amino-2-methoxyphenyl)-2-(2,4-dichlorophenoxy)propanamide
  • Propanamide, N-(5-amino-2-methoxyphenyl)-2-(2,4-dichlorophenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.