CAS 1020054-52-7

N-(3-Amino-4-chlorophenyl)-2-(4-ethylphenoxy)acetamide

Description:

N-(3-Amino-4-chlorophenyl)-2-(4-ethylphenoxy)acetamide, identified by its CAS number 1020054-52-7, is a chemical compound characterized by its specific functional groups and structural features. It contains an acetamide moiety, which is indicative of its potential as a pharmaceutical agent. The presence of an amino group and a chlorophenyl ring suggests that it may exhibit biological activity, possibly interacting with various biological targets. The ethylphenoxy group contributes to its lipophilicity, which can influence its solubility and permeability in biological systems. This compound may be of interest in medicinal chemistry, particularly in the development of drugs targeting specific pathways or conditions. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties, such as melting point, solubility, and spectral data, would be essential for understanding its behavior in different environments. Further studies would be necessary to elucidate its pharmacological profile and potential applications in therapeutic contexts.

Formula: C₁₆H₁₇ClN₂O₂

InChI: InChI=1S/C16H17ClN2O2/c1-2-11-3-6-13(7-4-11)21-10-16(20)19-12-5-8-14(17)15(18)9-12/h3-9H,2,10,18H2,1H3,(H,19,20)

InChI key: InChIKey=VUTKKAHWNQFVRQ-UHFFFAOYSA-N

SMILES: N(C(COC1=CC=C(CC)C=C1)=O)C2=CC(N)=C(Cl)C=C2

Synonyms:

• Acetamide, N-(3-amino-4-chlorophenyl)-2-(4-ethylphenoxy)-
• N-(3-Amino-4-chlorophenyl)-2-(4-ethylphenoxy)acetamide