CAS 1020055-90-6

N-(3-Amino-4-chlorophenyl)octanamide

Description:

N-(3-Amino-4-chlorophenyl)octanamide is an organic compound characterized by its amide functional group, which is derived from octanoic acid and an aromatic amine. The presence of the 3-amino-4-chlorophenyl group indicates that it has both amino and chloro substituents on the aromatic ring, contributing to its chemical reactivity and potential biological activity. This compound is likely to exhibit moderate to high lipophilicity due to the long octyl chain, which can influence its solubility in organic solvents and its interaction with biological membranes. The amino group may participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the chlorophenyl moiety can affect the compound's electronic properties, potentially influencing its reactivity and interaction with other molecules. Given its structural features, N-(3-Amino-4-chlorophenyl)octanamide may have applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₄H₂₁ClN₂O

InChI: InChI=1S/C14H21ClN2O/c1-2-3-4-5-6-7-14(18)17-11-8-9-12(15)13(16)10-11/h8-10H,2-7,16H2,1H3,(H,17,18)

InChI key: InChIKey=USDHZVJEGSNIBP-UHFFFAOYSA-N

SMILES: N(C(CCCCCCC)=O)C1=CC(N)=C(Cl)C=C1

Synonyms:

• Octanamide, N-(3-amino-4-chlorophenyl)-
• N-(3-Amino-4-chlorophenyl)octanamide