
CAS 1020056-34-1
:N-(4-Aminophenyl)-4-(pentyloxy)benzamide
Description:
N-(4-Aminophenyl)-4-(pentyloxy)benzamide, identified by its CAS number 1020056-34-1, is an organic compound characterized by its amide functional group and aromatic structure. This substance features a pentyloxy group, which contributes to its hydrophobic properties, enhancing its solubility in organic solvents. The presence of the amino group on the aromatic ring suggests potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions, including coupling reactions in organic synthesis. Its structural components indicate that it may exhibit biological activity, potentially serving as a pharmaceutical intermediate or a ligand in medicinal chemistry. The compound's molecular interactions could be influenced by the length of the pentyloxy chain, which may affect its lipophilicity and overall pharmacokinetic properties. Additionally, the compound's stability, melting point, and solubility would depend on its specific molecular interactions and the environment in which it is studied. Overall, N-(4-Aminophenyl)-4-(pentyloxy)benzamide presents a versatile framework for further exploration in chemical and biological applications.
Formula:C18H22N2O2
InChI:InChI=1S/C18H22N2O2/c1-2-3-4-13-22-17-11-5-14(6-12-17)18(21)20-16-9-7-15(19)8-10-16/h5-12H,2-4,13,19H2,1H3,(H,20,21)
InChI key:InChIKey=VGVCUZFLDKPHHB-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(N)C=C1)(=O)C2=CC=C(OCCCCC)C=C2
Synonyms:- N-(4-Aminophenyl)-4-(pentyloxy)benzamide
- Benzamide, N-(4-aminophenyl)-4-(pentyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.