
CAS 1020056-73-8
:N-(5-Amino-2-fluorophenyl)-2-(2-methoxyphenoxy)propanamide
Description:
N-(5-Amino-2-fluorophenyl)-2-(2-methoxyphenoxy)propanamide, with the CAS number 1020056-73-8, is a chemical compound characterized by its complex structure, which includes an amine group, a fluorinated aromatic ring, and a methoxyphenoxy moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential hydrogen bonding capabilities due to the presence of the amine and carbonyl groups. The fluorine atom in the aromatic ring can influence the compound's electronic properties, potentially enhancing its reactivity and biological activity. The methoxy group may also contribute to the compound's lipophilicity, affecting its pharmacokinetics if it is evaluated for biological applications. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its physical and chemical properties, as well as its biological activity.
Formula:C16H17FN2O3
InChI:InChI=1S/C16H17FN2O3/c1-10(22-15-6-4-3-5-14(15)21-2)16(20)19-13-9-11(18)7-8-12(13)17/h3-10H,18H2,1-2H3,(H,19,20)
InChI key:InChIKey=BURWVLSHSSBSHH-UHFFFAOYSA-N
SMILES:O(C(C(NC1=C(F)C=CC(N)=C1)=O)C)C2=C(OC)C=CC=C2
Synonyms:- N-(5-Amino-2-fluorophenyl)-2-(2-methoxyphenoxy)propanamide
- Propanamide, N-(5-amino-2-fluorophenyl)-2-(2-methoxyphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.