
CAS 1020057-93-5
:N-(4-Amino-2-methylphenyl)-3-ethoxybenzamide
Description:
N-(4-Amino-2-methylphenyl)-3-ethoxybenzamide, identified by its CAS number 1020057-93-5, is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a substituted aniline structure, with an amino group and a methyl group on the aromatic ring, contributing to its potential biological activity. The presence of the ethoxy group enhances its solubility in organic solvents, which can influence its reactivity and interaction with biological targets. Typically, compounds of this nature may exhibit properties such as moderate to high melting points, depending on their molecular interactions and crystalline structure. They may also show potential as pharmaceutical agents, given the presence of functional groups that can participate in hydrogen bonding and other intermolecular interactions. Overall, the specific characteristics, including solubility, stability, and reactivity, would depend on the compound's molecular structure and the conditions under which it is studied.
Formula:C16H18N2O2
InChI:InChI=1S/C16H18N2O2/c1-3-20-14-6-4-5-12(10-14)16(19)18-15-8-7-13(17)9-11(15)2/h4-10H,3,17H2,1-2H3,(H,18,19)
InChI key:InChIKey=NDQLHRDYAZDKNB-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC(OCC)=CC=C1)C2=C(C)C=C(N)C=C2
Synonyms:- Benzamide, N-(4-amino-2-methylphenyl)-3-ethoxy-
- N-(4-Amino-2-methylphenyl)-3-ethoxybenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.