
CAS 102014-75-5
:5-Ethyl-4-hydroxy-2-piperidinone
Description:
5-Ethyl-4-hydroxy-2-piperidinone, with the CAS number 102014-75-5, is a chemical compound characterized by its piperidinone structure, which includes a six-membered ring containing nitrogen. This compound features an ethyl group and a hydroxyl group, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents, which is common for compounds containing hydroxyl groups. The presence of the piperidinone moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. The hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the ethyl substituent may affect the compound's lipophilicity, impacting its pharmacokinetic properties. Overall, 5-Ethyl-4-hydroxy-2-piperidinone is of interest in various chemical and biological research fields, although specific applications and biological activities would require further investigation.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-2-5-4-8-7(10)3-6(5)9/h5-6,9H,2-4H2,1H3,(H,8,10)
InChI key:InChIKey=CPFUCPCVUZBTNN-UHFFFAOYSA-N
SMILES:C(C)C1C(O)CC(=O)NC1
Synonyms:- 2-Piperidinone, 5-ethyl-4-hydroxy-
- 5-Ethyl-4-hydroxy-2-piperidinone
- 2-Piperidone, 5-ethyl-4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
