CymitQuimica logo

CAS 1020198-58-6

:

2-Bromo-1-chloro-3,5-difluorobenzene

Description:
2-Bromo-1-chloro-3,5-difluorobenzene is an aromatic halogenated compound characterized by the presence of multiple halogen substituents on a benzene ring. Specifically, it features a bromine atom at the second position, a chlorine atom at the first position, and fluorine atoms at the third and fifth positions of the benzene ring. This substitution pattern contributes to its unique chemical properties, including increased reactivity and potential for participation in electrophilic aromatic substitution reactions. The presence of electronegative halogens influences the compound's polarity and solubility, making it more soluble in organic solvents compared to non-halogenated benzene derivatives. Additionally, the compound may exhibit distinct physical properties such as boiling and melting points that differ from those of its unsubstituted counterparts. Due to its halogen content, 2-bromo-1-chloro-3,5-difluorobenzene may also have applications in organic synthesis and materials science, particularly in the development of pharmaceuticals or agrochemicals. Safety and handling precautions are essential due to the potential toxicity of halogenated compounds.
Formula:C6H2BrClF2
InChI:InChI=1S/C6H2BrClF2/c7-6-4(8)1-3(9)2-5(6)10/h1-2H
InChI key:QOFBXVZPBPTCJH-UHFFFAOYSA-N
SMILES:c1c(cc(c(c1Cl)Br)F)F
Synonyms:
  • 1-Bromo-2-chloro-4,6-diflorobenzene
  • 1-Bromo-2-chloro-4,6-difluorobenzene
  • 2-Bromo-1-chloro-3,5-difluorobenzene 95%
  • Benzene, 2-broMo-1-chloro-3,5-difluoro-
Found 4 products.