CAS 10202-75-2
:4-ALLYL-1,6-HEPTADIEN-4-OL
Description:
4-Allyl-1,6-heptadien-4-ol, with the CAS number 10202-75-2, is an organic compound characterized by its unique structure featuring a long carbon chain with multiple double bonds and a hydroxyl group. This compound belongs to the class of alcohols and is notable for its conjugated diene system, which can impart interesting reactivity and stability properties. The presence of the allyl group enhances its potential for various chemical reactions, including polymerization and cross-linking. Typically, compounds like this may exhibit moderate to high volatility and can have a distinct odor, often associated with unsaturated alcohols. Its solubility in organic solvents is generally good, while its solubility in water may vary depending on the specific functional groups present. Due to its structural features, 4-allyl-1,6-heptadien-4-ol may find applications in organic synthesis, fragrance formulations, or as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H16O
InChI:InChI=1/C10H16O/c1-4-7-10(11,8-5-2)9-6-3/h4-6,11H,1-3,7-9H2
SMILES:C=CCC(CC=C)(CC=C)O
Synonyms:- Triallylcarbinol
- 4-Allyl-1,6-Heptadiene-4-Ol
- Akos Bb-2867
- 4-(Prop-2-En-1-Yl)Hepta-1,6-Dien-4-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Allyl-1,6-heptadien-4-ol, 99%
CAS:A highly diastereoselective synthesis of homoallylic alcohols bearing up to two adjacent quaternary centers was achieved using these polysubstituted allylic reagents. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and labelFormula:C10H16OPurity:99%Color and Shape:Clear colorless, LiquidMolecular weight:152.241,6-HEPTADIEN-4-OL, 4-(2-PROPEN-1-YL)-
CAS:Formula:C10H16OPurity:98%Color and Shape:LiquidMolecular weight:152.2334



