CAS 1020238-70-3

1-[(4-Methoxyphenyl)methyl]-5-methyl-1H-pyrazole-3-carboxylic acid

Description:

1-[(4-Methoxyphenyl)methyl]-5-methyl-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a methoxyphenyl group at one position and a carboxylic acid functional group at another position contributes to its potential biological activity and solubility properties. The methyl group attached to the pyrazole ring enhances its lipophilicity, which may influence its interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in areas related to anti-inflammatory or analgesic activities. The compound's molecular interactions, stability, and reactivity can be influenced by the substituents on the pyrazole ring, which may also affect its synthesis and purification processes. Overall, this compound represents a unique scaffold for further exploration in chemical and pharmaceutical research.

Formula: C₁₃H₁₄N₂O₃

InChI: InChI=1S/C13H14N2O3/c1-9-7-12(13(16)17)14-15(9)8-10-3-5-11(18-2)6-4-10/h3-7H,8H2,1-2H3,(H,16,17)

InChI key: InChIKey=QSLRSLIEJFJOOI-UHFFFAOYSA-N

SMILES: C(N1N=C(C(O)=O)C=C1C)C2=CC=C(OC)C=C2

Synonyms:

• 1-[(4-Methoxyphenyl)methyl]-5-methyl-1H-pyrazole-3-carboxylic acid
• 1H-Pyrazole-3-carboxylic acid, 1-[(4-methoxyphenyl)methyl]-5-methyl-