CymitQuimica logo

CAS 1020241-85-3

:

1,1′-Dimethyl 3,3′-[(2-amino-1,4-phenylene)bis(oxy)]bis[propanoate]

Description:
1,1′-Dimethyl 3,3′-[(2-amino-1,4-phenylene)bis(oxy)]bis[propanoate], with the CAS number 1020241-85-3, is a chemical compound characterized by its complex structure, which includes multiple functional groups. This substance features a dimethyl group, indicating the presence of two methyl groups attached to a central framework. The compound contains an amino group, which contributes to its potential reactivity and ability to form hydrogen bonds, enhancing its solubility in polar solvents. The bis(oxy) linkage suggests the presence of ether functionalities, which can influence the compound's physical properties, such as melting and boiling points. Additionally, the propanoate moieties indicate that it may exhibit ester-like characteristics, potentially affecting its reactivity and interactions with biological systems. Overall, this compound's unique structural features may lend it applications in fields such as pharmaceuticals, materials science, or as a biochemical probe, although specific applications would depend on further research into its properties and behavior in various environments.
Formula:C14H19NO6
InChI:InChI=1S/C14H19NO6/c1-18-13(16)5-7-20-10-3-4-12(11(15)9-10)21-8-6-14(17)19-2/h3-4,9H,5-8,15H2,1-2H3
InChI key:InChIKey=DIVBWMFUOLZMMK-UHFFFAOYSA-N
SMILES:O(CCC(OC)=O)C1=CC(N)=C(OCCC(OC)=O)C=C1
Synonyms:
  • Propanoic acid, 3,3′-[(2-amino-1,4-phenylene)bis(oxy)]bis-, 1,1′-dimethyl ester
  • 1,1′-Dimethyl 3,3′-[(2-amino-1,4-phenylene)bis(oxy)]bis[propanoate]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.