CAS 1020243-95-1
:6-Amino-2-(3-methyl-1-piperidinyl)-4(3H)-pyrimidinone
Description:
6-Amino-2-(3-methyl-1-piperidinyl)-4(3H)-pyrimidinone, identified by its CAS number 1020243-95-1, is a chemical compound that features a pyrimidinone core structure with an amino group and a piperidine substituent. This compound is characterized by its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the amino group enhances its solubility and reactivity, while the piperidine ring contributes to its pharmacokinetic properties. Typically, such compounds may exhibit properties like moderate to high polarity, which can influence their interaction with biological targets. The molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, making it a candidate for further research in drug design. Additionally, the presence of a methyl group on the piperidine ring may affect the compound's steric and electronic properties, influencing its overall biological activity and specificity.
Formula:C10H16N4O
InChI:InChI=1S/C10H16N4O/c1-7-3-2-4-14(6-7)10-12-8(11)5-9(15)13-10/h5,7H,2-4,6H2,1H3,(H3,11,12,13,15)
InChI key:InChIKey=MJZFRRUTCMKNBI-UHFFFAOYSA-N
SMILES:NC=1NC(=NC(=O)C1)N2CC(C)CCC2
Synonyms:- 4(3H)-Pyrimidinone, 6-amino-2-(3-methyl-1-piperidinyl)-
- 6-Amino-2-(3-methyl-1-piperidinyl)-4(3H)-pyrimidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.