CAS 1020252-17-8

2-(4-Chloro-2-methylphenoxy)-6-fluorobenzonitrile

Description:

2-(4-Chloro-2-methylphenoxy)-6-fluorobenzonitrile, with the CAS number 1020252-17-8, is a chemical compound characterized by its complex aromatic structure. It features a chlorinated and methyl-substituted phenyl group linked to a fluorinated benzonitrile moiety. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of functional groups that can participate in various chemical reactions. The chlorinated and fluorinated substituents may enhance its biological activity or stability. Additionally, the presence of the nitrile group indicates potential for reactivity, making it a candidate for further chemical transformations. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, this compound's unique structure and properties make it of interest in synthetic chemistry and material science.

Formula: C₁₄H₉ClFNO

InChI: InChI=1S/C14H9ClFNO/c1-9-7-10(15)5-6-13(9)18-14-4-2-3-12(16)11(14)8-17/h2-7H,1H3

InChI key: InChIKey=GKULZZNWGYNUSD-UHFFFAOYSA-N

SMILES: C(#N)C1=C(OC2=C(C)C=C(Cl)C=C2)C=CC=C1F

Synonyms:

• Benzonitrile, 2-(4-chloro-2-methylphenoxy)-6-fluoro-
• 2-(4-Chloro-2-methylphenoxy)-6-fluorobenzonitrile

2-(4-chloro-2-methylphenoxy)-6-fluorobenzenecarbonitrile

CAS: 1020252-17-8

Please enquire for more information about 2-(4-chloro-2-methylphenoxy)-6-fluorobenzenecarbonitrile including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Ref: 3D-FC169044