CAS 1020252-23-6

5-[[[2-(3,4-Dimethoxyphenyl)ethyl]amino]methylene]-2,2-dimethyl-1,3-dioxane-4,6-dione

Description:

The chemical substance known as 5-[[[2-(3,4-Dimethoxyphenyl)ethyl]amino]methylene]-2,2-dimethyl-1,3-dioxane-4,6-dione, with the CAS number 1020252-23-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a dioxane ring and multiple functional groups. This compound features a dimethoxyphenyl moiety, contributing to its potential biological activity and solubility properties. The presence of the amino group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The dioxane portion of the molecule may impart stability and influence the compound's reactivity. Additionally, the presence of the methylene bridge indicates potential for conformational flexibility, which can affect its pharmacokinetic properties. Overall, this compound's unique structure may lead to diverse applications in pharmaceuticals, particularly in the development of therapeutic agents. Further studies would be necessary to elucidate its specific properties, biological activities, and potential uses in various fields.

Formula: C₁₇H₂₁NO₆

InChI: InChI=1S/C17H21NO6/c1-17(2)23-15(19)12(16(20)24-17)10-18-8-7-11-5-6-13(21-3)14(9-11)22-4/h5-6,9-10,18H,7-8H2,1-4H3

InChI key: InChIKey=GTLWGXHYGYVFIV-UHFFFAOYSA-N

SMILES: C(NCCC1=CC(OC)=C(OC)C=C1)=C2C(=O)OC(C)(C)OC2=O

Synonyms:

• 5-[[[2-(3,4-Dimethoxyphenyl)ethyl]amino]methylene]-2,2-dimethyl-1,3-dioxane-4,6-dione
• 1,3-Dioxane-4,6-dione, 5-[[[2-(3,4-dimethoxyphenyl)ethyl]amino]methylene]-2,2-dimethyl-

5-(((2-(3,4-dimethoxyphenyl)ethyl)amino)methylene)-2,2-dimethyl-1,3-dioxane-4,6-dione

CAS: 1020252-23-6

Please enquire for more information about 5-(((2-(3,4-dimethoxyphenyl)ethyl)amino)methylene)-2,2-dimethyl-1,3-dioxane-4,6-dione including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Ref: 3D-FD169887