CAS 1020252-80-5
:4-Bromo-N-cyclohexyl-3-methylbenzamide
Description:
4-Bromo-N-cyclohexyl-3-methylbenzamide is an organic compound characterized by its structural features, which include a bromine atom, a cyclohexyl group, and a methyl group attached to a benzamide framework. The presence of the bromine substituent typically imparts unique reactivity and can influence the compound's physical properties, such as solubility and boiling point. The cyclohexyl group contributes to the compound's hydrophobic characteristics, while the methyl group can affect steric hindrance and electronic properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular interactions can be influenced by the functional groups present, potentially leading to varied applications in pharmaceuticals or agrochemicals. Additionally, the compound's stability, reactivity, and potential toxicity would need to be evaluated in a laboratory setting to understand its behavior in different environments. As with many organic compounds, proper handling and safety measures are essential due to potential hazards associated with its chemical structure.
Formula:C14H18BrNO
InChI:InChI=1S/C14H18BrNO/c1-10-9-11(7-8-13(10)15)14(17)16-12-5-3-2-4-6-12/h7-9,12H,2-6H2,1H3,(H,16,17)
InChI key:InChIKey=PIJTYHXMAMHDAB-UHFFFAOYSA-N
SMILES:C(NC1CCCCC1)(=O)C2=CC(C)=C(Br)C=C2
Synonyms:- Benzamide, 4-bromo-N-cyclohexyl-3-methyl-
- 4-Bromo-N-cyclohexyl-3-methylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
