CAS 1020252-81-6

4-Bromo-3-methyl-N-phenylbenzamide

Description:

4-Bromo-3-methyl-N-phenylbenzamide is an organic compound characterized by its structural features, which include a bromine atom, a methyl group, and a phenyl group attached to a benzamide backbone. This compound typically exhibits a crystalline solid form and is soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water due to its hydrophobic characteristics. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The methyl and phenyl substituents can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with biological systems. As with many aromatic compounds, it may exhibit UV-Vis absorbance characteristics, which can be utilized in analytical applications. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal procedures should be followed. Overall, 4-Bromo-3-methyl-N-phenylbenzamide is of interest in synthetic organic chemistry and potentially in pharmaceutical applications.

Formula: C₁₄H₁₂BrNO

InChI: InChI=1S/C14H12BrNO/c1-10-9-11(7-8-13(10)15)14(17)16-12-5-3-2-4-6-12/h2-9H,1H3,(H,16,17)

InChI key: InChIKey=DITUUIPFJXYABP-UHFFFAOYSA-N

SMILES: C(NC1=CC=CC=C1)(=O)C2=CC(C)=C(Br)C=C2

Synonyms:

• Benzamide, 4-bromo-3-methyl-N-phenyl-
• 4-Bromo-3-methyl-N-phenylbenzamide

N-Phenyl 4-bromo-3-methylbenzamide

CAS: 1020252-81-6

Formula: C₁₄H₁₂BrNO

Molecular weight: 290.1552

Ref: IN-DA0006CN