CymitQuimica logo

CAS 1020252-83-8

:

3-Bromo-N-butyl-5-(trifluoromethyl)benzenesulfonamide

Description:
3-Bromo-N-butyl-5-(trifluoromethyl)benzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its applications in pharmaceuticals and agrochemicals. The presence of a bromine atom and a trifluoromethyl group enhances its reactivity and lipophilicity, making it a valuable intermediate in synthetic chemistry. The butyl group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound typically exhibits moderate stability under standard conditions but may undergo hydrolysis or substitution reactions in the presence of nucleophiles. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Additionally, the trifluoromethyl group is often associated with increased metabolic stability and bioactivity. Safety and handling precautions are essential due to the presence of bromine and sulfonamide functionalities, which may pose health risks. Overall, 3-Bromo-N-butyl-5-(trifluoromethyl)benzenesulfonamide is a compound of interest in various chemical research fields.
Formula:C11H13BrF3NO2S
InChI:InChI=1S/C11H13BrF3NO2S/c1-2-3-4-16-19(17,18)10-6-8(11(13,14)15)5-9(12)7-10/h5-7,16H,2-4H2,1H3
InChI key:InChIKey=IJPATHMDDIDFND-UHFFFAOYSA-N
SMILES:S(NCCCC)(=O)(=O)C1=CC(C(F)(F)F)=CC(Br)=C1
Synonyms:
  • 3-Bromo-N-butyl-5-(trifluoromethyl)benzenesulfonamide
  • Benzenesulfonamide, 3-bromo-N-butyl-5-(trifluoromethyl)-
  • 3-Bromo-5-trifluoromethylbenzenesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.