CAS 1020252-85-0
:3-Bromo-5-methyl-N-(phenylmethyl)benzenesulfonamide
Description:
3-Bromo-5-methyl-N-(phenylmethyl)benzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a bromine atom at the 3-position and a methyl group at the 5-position on the benzene ring contributes to its unique reactivity and potential applications in medicinal chemistry. The N-(phenylmethyl) substituent indicates that the compound has a phenyl group attached to a methyl group, which can influence its solubility and biological activity. This compound may exhibit properties such as moderate to high lipophilicity due to the aromatic rings, which can affect its pharmacokinetics. Additionally, the sulfonamide group can participate in hydrogen bonding, enhancing its interactions with biological targets. Overall, 3-Bromo-5-methyl-N-(phenylmethyl)benzenesulfonamide represents a class of compounds that may be explored for their therapeutic potential, particularly in the development of new pharmaceuticals.
Formula:C14H14BrNO2S
InChI:InChI=1S/C14H14BrNO2S/c1-11-7-13(15)9-14(8-11)19(17,18)16-10-12-5-3-2-4-6-12/h2-9,16H,10H2,1H3
InChI key:InChIKey=BXIBJXHCGWEKOT-UHFFFAOYSA-N
SMILES:S(NCC1=CC=CC=C1)(=O)(=O)C2=CC(Br)=CC(C)=C2
Synonyms:- Benzenesulfonamide, 3-bromo-5-methyl-N-(phenylmethyl)-
- 3-Bromo-5-methyl-N-(phenylmethyl)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
