CAS 1020252-88-3
:5-(3-Chlorophenyl)-4-oxazolemethanol
Description:
5-(3-Chlorophenyl)-4-oxazolemethanol is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of the 3-chlorophenyl group indicates that there is a chlorine substituent on the phenyl ring, which can influence the compound's reactivity and biological activity. This compound may exhibit properties typical of oxazole derivatives, such as potential antimicrobial or anti-inflammatory activities, making it of interest in medicinal chemistry. The hydroxymethyl group (-CH2OH) attached to the oxazole ring can also enhance solubility and reactivity, potentially allowing for further chemical modifications. The specific interactions and applications of this compound would depend on its precise structure and the functional groups present, which can affect its pharmacokinetics and pharmacodynamics. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances.
Formula:C10H8ClNO2
InChI:InChI=1S/C10H8ClNO2/c11-8-3-1-2-7(4-8)10-9(5-13)12-6-14-10/h1-4,6,13H,5H2
InChI key:InChIKey=MAIWQXMACJPOBD-UHFFFAOYSA-N
SMILES:C(O)C1=C(OC=N1)C2=CC(Cl)=CC=C2
Synonyms:- 4-Oxazolemethanol, 5-(3-chlorophenyl)-
- 5-(3-Chlorophenyl)-4-hydroxymethyloxazole
- 5-(3-Chlorophenyl)-4-oxazolemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
