CAS 1020252-90-7

3-Bromo-N-(2-furanylmethyl)-5-methylbenzenesulfonamide

Description:

3-Bromo-N-(2-furanylmethyl)-5-methylbenzenesulfonamide is a chemical compound characterized by its unique structural features, which include a bromine atom, a furan ring, and a sulfonamide functional group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The furan moiety contributes to the compound's aromaticity and can participate in electrophilic aromatic substitution reactions. The sulfonamide group enhances the compound's solubility in polar solvents and may impart biological activity, as sulfonamides are known for their antimicrobial properties. This compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including chromatography and spectroscopy for purity and structural confirmation. Overall, 3-Bromo-N-(2-furanylmethyl)-5-methylbenzenesulfonamide represents a versatile compound with potential implications in both synthetic and medicinal chemistry.

Formula: C₁₂H₁₂BrNO₃S

InChI: InChI=1S/C12H12BrNO3S/c1-9-5-10(13)7-12(6-9)18(15,16)14-8-11-3-2-4-17-11/h2-7,14H,8H2,1H3

InChI key: InChIKey=HWLMNIIANXRHGE-UHFFFAOYSA-N

SMILES: S(NCC1=CC=CO1)(=O)(=O)C2=CC(Br)=CC(C)=C2

Synonyms:

• 3-Bromo-N-(2-furanylmethyl)-5-methylbenzenesulfonamide
• Benzenesulfonamide, 3-bromo-N-(2-furanylmethyl)-5-methyl-

N-(Furan-2-ylmethyl) 3-bromo-5-methylbenzenesulfonamide

CAS: 1020252-90-7

Formula: C₁₂H₁₂BrNO₃S

Molecular weight: 330.1976

Ref: IN-DA0006CE