CAS 1020252-92-9
:3-Bromo-N,N,5-trimethylbenzenesulfonamide
Description:
3-Bromo-N,N,5-trimethylbenzenesulfonamide is an organic compound characterized by the presence of a bromine atom and a sulfonamide functional group attached to a trimethyl-substituted benzene ring. The sulfonamide group (-SO2NH2) is known for its ability to form hydrogen bonds, which can influence the compound's solubility and reactivity. The presence of the bromine atom introduces a halogen, which can enhance the compound's electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The trimethyl groups on the benzene ring contribute to steric hindrance, potentially affecting the compound's reactivity and interactions with other molecules. This compound may exhibit interesting biological activities, as sulfonamides are often associated with antimicrobial properties. Its specific applications can vary, but it may be utilized in pharmaceutical research or as an intermediate in organic synthesis. Overall, the unique combination of functional groups and substituents in 3-Bromo-N,N,5-trimethylbenzenesulfonamide makes it a compound of interest in both synthetic and medicinal chemistry.
Formula:C9H12BrNO2S
InChI:InChI=1S/C9H12BrNO2S/c1-7-4-8(10)6-9(5-7)14(12,13)11(2)3/h4-6H,1-3H3
InChI key:InChIKey=SHWGLGYUOLHVGA-UHFFFAOYSA-N
SMILES:S(N(C)C)(=O)(=O)C1=CC(Br)=CC(C)=C1
Synonyms:- 3-Bromo-N,N,5-trimethylbenzene-1-sulfonamide
- 3-Bromo-N,N,5-trimethylbenzenesulfonamide
- Benzenesulfonamide, 3-bromo-N,N,5-trimethyl-
- 3-Bromo-N,N-dimethyl-5-methylbenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
