CAS 1020252-95-2
:1-[(3-Bromo-5-methylphenyl)sulfonyl]piperidine
Description:
1-[(3-Bromo-5-methylphenyl)sulfonyl]piperidine is a chemical compound characterized by its piperidine core, which is a six-membered nitrogen-containing heterocycle. The presence of a sulfonyl group attached to a phenyl ring, specifically a 3-bromo-5-methylphenyl moiety, contributes to its unique reactivity and properties. The bromine atom introduces a halogen functionality, which can participate in various chemical reactions, such as nucleophilic substitutions. The methyl group on the phenyl ring can influence the compound's lipophilicity and steric properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its sulfonyl group can enhance solubility and stability, while the piperidine ring may contribute to interactions with biological targets. Overall, the structural features of 1-[(3-Bromo-5-methylphenyl)sulfonyl]piperidine suggest potential applications in drug design and synthesis, although specific biological activities would require further investigation.
Formula:C12H16BrNO2S
InChI:InChI=1S/C12H16BrNO2S/c1-10-7-11(13)9-12(8-10)17(15,16)14-5-3-2-4-6-14/h7-9H,2-6H2,1H3
InChI key:InChIKey=JLUJPVCLBZIGRS-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC(Br)=CC(C)=C1)N2CCCCC2
Synonyms:- 1-[(3-Bromo-5-methylphenyl)sulfonyl]piperidine
- Piperidine, 1-[(3-bromo-5-methylphenyl)sulfonyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
