CAS 1020252-96-3

1-[(3-Bromo-5-methylphenyl)sulfonyl]pyrrolidine

Description:

1-[(3-Bromo-5-methylphenyl)sulfonyl]pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a sulfonyl group attached to a substituted phenyl moiety. The presence of the bromine atom and the methyl group on the phenyl ring contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The sulfonyl group enhances the compound's polarity, which can influence its solubility and interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in drug development. Additionally, its CAS number, 1020252-96-3, allows for easy identification and retrieval of information related to its synthesis, properties, and potential uses in various chemical applications. As with many sulfonyl-containing compounds, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry.

Formula: C₁₁H₁₄BrNO₂S

InChI: InChI=1S/C11H14BrNO2S/c1-9-6-10(12)8-11(7-9)16(14,15)13-4-2-3-5-13/h6-8H,2-5H2,1H3

InChI key: InChIKey=NWPCLECTVGVBLW-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC(Br)=CC(C)=C1)N2CCCC2

Synonyms:

• 1-[(3-Bromo-5-methylphenyl)sulfonyl]pyrrolidine
• Pyrrolidine, 1-[(3-bromo-5-methylphenyl)sulfonyl]-

1-(3-Bromo-5-methylphenylsulfonyl)pyrrolidine

CAS: 1020252-96-3

Formula: C₁₁H₁₄BrNO₂S

Molecular weight: 304.2034

Ref: IN-DA0006DM