CymitQuimica logo

CAS 1020252-97-4

:

4-Bromo-N-(2-furanylmethyl)-3-(trifluoromethyl)benzenesulfonamide

Description:
4-Bromo-N-(2-furanylmethyl)-3-(trifluoromethyl)benzenesulfonamide is a chemical compound characterized by its complex structure, which includes a bromine atom, a trifluoromethyl group, and a furan moiety. The presence of the sulfonamide functional group indicates potential applications in medicinal chemistry, particularly as a pharmacophore in drug design. This compound is likely to exhibit polar characteristics due to the sulfonamide and trifluoromethyl groups, which can influence its solubility and reactivity. The furan ring contributes to its aromaticity and may enhance biological activity through interactions with biological targets. Additionally, the bromine atom can serve as a site for further chemical modifications, making it a versatile intermediate in synthetic chemistry. The compound's unique combination of functional groups suggests potential applications in various fields, including pharmaceuticals and agrochemicals, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed, as with any chemical substance, particularly those containing halogens and sulfonamides.
Formula:C12H9BrF3NO3S
InChI:InChI=1S/C12H9BrF3NO3S/c13-11-4-3-9(6-10(11)12(14,15)16)21(18,19)17-7-8-2-1-5-20-8/h1-6,17H,7H2
InChI key:InChIKey=KZZVCZPJQLDWLR-UHFFFAOYSA-N
SMILES:S(NCC1=CC=CO1)(=O)(=O)C2=CC(C(F)(F)F)=C(Br)C=C2
Synonyms:
  • Benzenesulfonamide, 4-bromo-N-(2-furanylmethyl)-3-(trifluoromethyl)-
  • 4-Bromo-N-(2-furanylmethyl)-3-(trifluoromethyl)benzenesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.