CAS 1020252-99-6

4-Bromo-N-ethyl-3-(trifluoromethyl)benzenesulfonamide

Description:

4-Bromo-N-ethyl-3-(trifluoromethyl)benzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group, a bromine atom, and a trifluoromethyl group attached to a benzene ring. The sulfonamide group contributes to its potential as a pharmaceutical agent, as sulfonamides are known for their antibacterial properties. The bromine atom introduces a halogen, which can influence the compound's reactivity and lipophilicity, while the trifluoromethyl group enhances its electronic properties and may improve its biological activity. This compound is likely to be a solid at room temperature, exhibiting moderate solubility in polar solvents due to the presence of the sulfonamide group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new drugs or agrochemicals. Safety and handling precautions should be observed, as compounds containing halogens and sulfonamides can pose health risks. Overall, 4-Bromo-N-ethyl-3-(trifluoromethyl)benzenesulfonamide represents a class of compounds with diverse applications in chemical research and industry.

Formula: C₉H₉BrF₃NO₂S

InChI: InChI=1S/C9H9BrF3NO2S/c1-2-14-17(15,16)6-3-4-8(10)7(5-6)9(11,12)13/h3-5,14H,2H2,1H3

InChI key: InChIKey=BTQIKMVDGYVIBP-UHFFFAOYSA-N

SMILES: S(NCC)(=O)(=O)C1=CC(C(F)(F)F)=C(Br)C=C1

Synonyms:

• Benzenesulfonamide, 4-bromo-N-ethyl-3-(trifluoromethyl)-
• 4-Bromo-N-ethyl-3-(trifluoromethyl)benzenesulfonamide

N-Ethyl 4-bromo-3-trifluoromethylbenzenesulfonamide

CAS: 1020252-99-6

Formula: C₉H₉BrF₃NO₂S

Molecular weight: 332.1375

Ref: IN-DA0006DJ