CAS 1020253-03-5

4-Bromo-N,N-diethyl-3-(trifluoromethyl)benzenesulfonamide

Description:

4-Bromo-N,N-diethyl-3-(trifluoromethyl)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its applications in pharmaceuticals and agrochemicals. The presence of a bromine atom and a trifluoromethyl group on the benzene ring contributes to its unique reactivity and hydrophobic properties. This compound is likely to exhibit moderate to high lipophilicity due to the bulky trifluoromethyl group, which can influence its solubility and permeability in biological systems. The diethyl substituents on the nitrogen atom enhance its steric bulk, potentially affecting its interaction with biological targets. Additionally, the sulfonamide moiety can participate in hydrogen bonding, which may play a role in its biological activity. Overall, this compound's structural features suggest it may have potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activity and toxicity profiles would require further investigation through experimental studies.

Formula: C₁₁H₁₃BrF₃NO₂S

InChI: InChI=1S/C11H13BrF3NO2S/c1-3-16(4-2)19(17,18)8-5-6-10(12)9(7-8)11(13,14)15/h5-7H,3-4H2,1-2H3

InChI key: InChIKey=YWTSSKIFTPDTJV-UHFFFAOYSA-N

SMILES: S(N(CC)CC)(=O)(=O)C1=CC(C(F)(F)F)=C(Br)C=C1

Synonyms:

• 4-Bromo-N,N-diethyl-3-(trifluoromethyl)benzenesulfonamide
• Benzenesulfonamide, 4-bromo-N,N-diethyl-3-(trifluoromethyl)-

N,N-Diethyl 4-bromo-3-trifluoromethylbenzenesulfonamide

CAS: 1020253-03-5

Formula: C₁₁H₁₃BrF₃NO₂S

Molecular weight: 360.1906

Ref: IN-DA0006DF