CAS 1020253-05-7
:4-Bromo-N-butyl-3-(trifluoromethyl)benzenesulfonamide
Description:
4-Bromo-N-butyl-3-(trifluoromethyl)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its applications in pharmaceuticals and agrochemicals. The presence of a bromine atom and a trifluoromethyl group contributes to its unique reactivity and hydrophobic properties. This compound typically exhibits moderate solubility in organic solvents, while its sulfonamide moiety can engage in hydrogen bonding, influencing its interaction with biological targets. The butyl group enhances its lipophilicity, potentially affecting its bioavailability and distribution in biological systems. Additionally, the trifluoromethyl group is known to increase metabolic stability and can influence the compound's electronic properties, making it a valuable scaffold in medicinal chemistry. Overall, 4-Bromo-N-butyl-3-(trifluoromethyl)benzenesulfonamide is a versatile compound with potential applications in drug development and material science, although specific biological activity and toxicity profiles would require further investigation.
Formula:C11H13BrF3NO2S
InChI:InChI=1S/C11H13BrF3NO2S/c1-2-3-6-16-19(17,18)8-4-5-10(12)9(7-8)11(13,14)15/h4-5,7,16H,2-3,6H2,1H3
InChI key:InChIKey=BULCCCDZIBVCBO-UHFFFAOYSA-N
SMILES:S(NCCCC)(=O)(=O)C1=CC(C(F)(F)F)=C(Br)C=C1
Synonyms:- Benzenesulfonamide, 4-bromo-N-butyl-3-(trifluoromethyl)-
- 4-Bromo-N-butyl-3-(trifluoromethyl)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Bromo-N-butyl-3-(trifluoromethyl)benzenesulfonamide
CAS:Formula:C11H13BrF3NO2SMolecular weight:360.1906
