CAS 1020253-08-0
:1-(3-Chloro-2-methylphenyl)piperidine
Description:
1-(3-Chloro-2-methylphenyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a chloro and a methyl substituent on a phenyl group, specifically at the 3 and 2 positions, respectively. This substitution pattern contributes to its unique chemical properties, including its potential for various interactions due to the presence of the chlorine atom, which can influence reactivity and polarity. The piperidine moiety imparts basicity to the compound, making it capable of forming salts with acids. Additionally, the presence of the aromatic ring enhances its stability and can affect its solubility in organic solvents. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could be relevant for biological activity. As with many organic compounds, safety and handling precautions should be observed, as it may exhibit toxicity or other hazardous properties.
Formula:C12H16ClN
InChI:InChI=1S/C12H16ClN/c1-10-11(13)6-5-7-12(10)14-8-3-2-4-9-14/h5-7H,2-4,8-9H2,1H3
InChI key:InChIKey=UQDJPOJUZFBCLB-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1Cl)N2CCCCC2
Synonyms:- 1-(3-Chloro-2-methylphenyl)piperidine
- Piperidine, 1-(3-chloro-2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
