CAS 1020253-12-6
:4-Bromo-2-fluoro-1-[[(4-methoxyphenyl)methyl]thio]benzene
Description:
4-Bromo-2-fluoro-1-[[(4-methoxyphenyl)methyl]thio]benzene is an organic compound characterized by the presence of a bromine atom, a fluorine atom, and a thioether functional group. The molecular structure features a benzene ring substituted with a methoxy group and a thioether linkage, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of both bromine and fluorine atoms introduces unique electronic properties, potentially enhancing the compound's lipophilicity and biological activity. The methoxyphenyl group can influence the compound's solubility and interaction with biological targets. Additionally, the compound's synthesis and stability may be affected by the steric and electronic effects of the substituents. Overall, this compound exemplifies the complexity of substituted aromatic systems and their potential utility in synthetic chemistry and drug development.
Formula:C14H12BrFOS
InChI:InChI=1S/C14H12BrFOS/c1-17-12-5-2-10(3-6-12)9-18-14-7-4-11(15)8-13(14)16/h2-8H,9H2,1H3
InChI key:InChIKey=XDHSLAPCAYVIAB-UHFFFAOYSA-N
SMILES:S(CC1=CC=C(OC)C=C1)C2=C(F)C=C(Br)C=C2
Synonyms:- Benzene, 4-bromo-2-fluoro-1-[[(4-methoxyphenyl)methyl]thio]-
- 4-Bromo-2-fluoro-1-[[(4-methoxyphenyl)methyl]thio]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
