CymitQuimica logo

CAS 1020253-25-1

:

Quinoline,8-bromo-6-(trifluoromethoxy)-

Description:
Quinoline, 8-bromo-6-(trifluoromethoxy)- is a heterocyclic organic compound characterized by its quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 8-position and a trifluoromethoxy group at the 6-position significantly influences its chemical properties and reactivity. This compound is typically a pale yellow to brown solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The trifluoromethoxy group enhances lipophilicity and can improve the compound's interaction with biological targets. Additionally, the bromine substituent can serve as a site for further chemical modifications, making it a versatile intermediate in organic synthesis. Its unique structure may also impart specific electronic properties, affecting its behavior in various chemical reactions. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental impact.
Formula:C10H5BrF3NO
InChI:InChI=1S/C10H5BrF3NO/c11-8-5-7(16-10(12,13)14)4-6-2-1-3-15-9(6)8/h1-5H
InChI key:VDJIPDVPISXOMB-UHFFFAOYSA-N
SMILES:C1=CC2=CC(=CC(=C2N=C1)Br)OC(F)(F)F
Synonyms:
  • 8-Bromo-6-trifluoromethoxyquinoline
Found 4 products.