CymitQuimica logo

CAS 1020253-86-4

:

Ethyl 1,3,4,6-tetrahydro-6-oxo-2H-pyrido[1,2-a]pyrimidine-9-carboxylate

Description:
Ethyl 1,3,4,6-tetrahydro-6-oxo-2H-pyrido[1,2-a]pyrimidine-9-carboxylate is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that contribute to its saturation. The presence of a carboxylate group suggests it may exhibit acidic properties, while the ethyl ester functionality indicates potential for reactivity and solubility in organic solvents. The oxo group contributes to the compound's reactivity, possibly participating in various chemical reactions such as nucleophilic attacks. Its unique structure may confer specific biological activities, making it of interest in medicinal chemistry. The compound's molecular weight, solubility, and stability can vary based on environmental conditions, such as pH and temperature. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in pharmaceuticals and other fields.
Formula:C11H14N2O3
InChI:InChI=1S/C11H14N2O3/c1-2-16-11(15)8-4-5-9(14)13-7-3-6-12-10(8)13/h4-5,12H,2-3,6-7H2,1H3
InChI key:InChIKey=MSMJOUSAHZUZJY-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2N(C(=O)C=C1)CCCN2
Synonyms:
  • Ethyl 1,3,4,6-tetrahydro-6-oxo-2H-pyrido[1,2-a]pyrimidine-9-carboxylate
  • 2H-Pyrido[1,2-a]pyrimidine-9-carboxylic acid, 1,3,4,6-tetrahydro-6-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.