CAS 102029-53-8: Guanosine, adenylyl-(3′→5′)-, monoammonium salt

Description:Guanosine, adenylyl-(3′→5′)-, monoammonium salt, commonly referred to as 3',5'-cyclic guanosine monophosphate (cGMP) in its active form, is a nucleotide derivative that plays a crucial role in cellular signaling processes. This compound is characterized by its cyclic structure, which is formed by the linkage of the 3' and 5' phosphate groups of guanosine. The presence of the ammonium salt form indicates that it can exist in a protonated state, which may influence its solubility and reactivity in biological systems. cGMP acts as a secondary messenger in various signaling pathways, particularly in response to nitric oxide and certain hormones, facilitating processes such as vasodilation and neurotransmission. Its stability and reactivity are influenced by environmental factors such as pH and temperature. Additionally, cGMP is involved in regulating various physiological functions, including smooth muscle relaxation and the modulation of ion channels. Understanding the characteristics of this compound is essential for its application in pharmacology and biochemistry.

Formula:C₂₀H₂₅N₁₀O₁₁P·H₃N

InChI:InChI=1S/C20H25N10O11P.H3N/c21-14-8-15(24-3-23-14)29(4-25-8)19-12(34)13(6(1-31)39-19)41-42(36,37)38-2-7-10(32)11(33)18(40-7)30-5-26-9-16(30)27-20(22)28-17(9)35;/h3-7,10-13,18-19,31-34H,1-2H2,(H,36,37)(H2,21,23,24)(H3,22,27,28,35);1H3/t6-,7-,10-,11-,12-,13-,18-,19-;/m1./s1

InChI key:InChIKey=PSMXGNLHMFLPGY-VSBWEBIMSA-N

SMILES:O=C1N=C(N)NC2=C1N=CN2C3OC(COP(=O)(O)OC4C(O)C(OC4CO)N5C=NC=6C(=NC=NC65)N)C(O)C3O.N

Synonyms:
Guanosine, adenylyl-(3′→5′)-, monoammonium salt

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Adenylyl-(3'-5')-guanosine REF: 3D-NA143918CAS: 102029-53-8	Min. 95%	To inquire	Thu 13 Mar 25
	Adenylyl-3'-5'-guanosine sodium salt REF: 3D-NA46044CAS: 102029-53-8	Min. 95%	803.00 €~3,976.00 €	Tue 29 Apr 25