
CAS 102029-53-8
:Guanosine, adenylyl-(3′→5′)-, monoammonium salt
Description:
Guanosine, adenylyl-(3′→5′)-, monoammonium salt, commonly referred to as 3',5'-cyclic guanosine monophosphate (cGMP) in its active form, is a nucleotide derivative that plays a crucial role in cellular signaling processes. This compound is characterized by its cyclic structure, which is formed by the linkage of the 3' and 5' phosphate groups of guanosine. The presence of the ammonium salt form indicates that it can exist in a protonated state, which may influence its solubility and reactivity in biological systems. cGMP acts as a secondary messenger in various signaling pathways, particularly in response to nitric oxide and certain hormones, facilitating processes such as vasodilation and neurotransmission. Its stability and reactivity are influenced by environmental factors such as pH and temperature. Additionally, cGMP is involved in regulating various physiological functions, including smooth muscle relaxation and the modulation of ion channels. Understanding the characteristics of this compound is essential for its application in pharmacology and biochemistry.
Formula:C20H25N10O11P·H3N
InChI:InChI=1S/C20H25N10O11P.H3N/c21-14-8-15(24-3-23-14)29(4-25-8)19-12(34)13(6(1-31)39-19)41-42(36,37)38-2-7-10(32)11(33)18(40-7)30-5-26-9-16(30)27-20(22)28-17(9)35;/h3-7,10-13,18-19,31-34H,1-2H2,(H,36,37)(H2,21,23,24)(H3,22,27,28,35);1H3/t6-,7-,10-,11-,12-,13-,18-,19-;/m1./s1
InChI key:InChIKey=PSMXGNLHMFLPGY-VSBWEBIMSA-N
SMILES:O[C@H]1[C@H](N2C3=C(N=C2)C(=O)N=C(N)N3)O[C@H](COP(O[C@@H]4[C@@H](CO)O[C@H]([C@@H]4O)N5C=6C(N=C5)=C(N)N=CN6)(=O)O)[C@H]1O.N
Synonyms:- Guanosine, adenylyl-(3′→5′)-, monoammonium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Adenylyl-(3'-5')-guanosine
CAS:Please enquire for more information about Adenylyl-(3'-5')-guanosine including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C20H25N10O11P·H3NPurity:Min. 95%Molecular weight:629.48 g/molAdenylyl-3'-5'-guanosine sodium salt
CAS:3'-Adenylyl-5'-guanosine ammonium salt is a dinucleoside that competes with guanosine for binding to the enzyme adenylate cyclase. This reaction leads to increased levels of cyclic AMP, which causes an increase in the rate of viral replication. 3'-Adenylyl-5'-guanosine ammonium salt has been shown to inhibit the growth of pyogenic bacteria such as Streptococcus pyogenes and has also been used to treat influenza infections. 3'-Adenylyl-5'-guanosine ammonium salt is an inorganic compound that is found in tobacco. It can be synthesized from uridine and p-nitrophenyl phosphate by the reaction: 3'--O--(CH2)4--COOH + H2N--PO4--> 3'--O--(CH2)4--CONH2 + H3PO4
Formula:C20H24N10O11P·NaPurity:Min. 95%Molecular weight:634.43 g/mol
