CAS 1020325-30-7

2-[3-(Chloromethyl)phenoxy]-5-(trifluoromethyl)pyridine

Description:

2-[3-(Chloromethyl)phenoxy]-5-(trifluoromethyl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with both a trifluoromethyl group and a phenoxy group that has a chloromethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of electronegative groups like chlorine and fluorine. The trifluoromethyl group is known for imparting lipophilicity and enhancing biological activity, while the chloromethyl group can serve as a reactive site for further chemical modifications. The presence of the pyridine ring suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent used, and could be subject to various chemical reactions, including nucleophilic substitutions or electrophilic aromatic substitutions. Safety and handling precautions should be observed due to the presence of halogenated groups, which can pose environmental and health risks.

Formula: C₁₃H₉ClF₃NO

InChI: InChI=1S/C13H9ClF3NO/c14-7-9-2-1-3-11(6-9)19-12-5-4-10(8-18-12)13(15,16)17/h1-6,8H,7H2

InChI key: InChIKey=HKECJZLWUZMCIC-UHFFFAOYSA-N

SMILES: O(C1=CC=C(C(F)(F)F)C=N1)C2=CC(CCl)=CC=C2

Synonyms:

• Pyridine, 2-[3-(chloromethyl)phenoxy]-5-(trifluoromethyl)-
• 2-[3-(Chloromethyl)phenoxy]-5-(trifluoromethyl)pyridine